About (Z)-but-2-enedioic acid;bis(diphenylphosphane)
(Z)-but-2-enedioic acid;bis(diphenylphosphane) (PubChem CID 172683592) has the molecular formula C28H26O4P2
and a molecular weight of 488.46 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;bis(diphenylphosphane).
Molecular Properties
| Compound Name | (Z)-but-2-enedioic acid;bis(diphenylphosphane) |
| PubChem CID | 172683592 |
| Molecular Formula | C28H26O4P2 |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | (Z)-but-2-enedioic acid;bis(diphenylphosphane) |
| SMILES | O=C(O)/C=C\C(=O)O.c1ccc(Pc2ccccc2)cc1.c1ccc(Pc2ccccc2)cc1 |
| InChI | InChI=1S/2C12H11P.C4H4O4/c2*1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;5-3(6)1-2-4(7)8/h2*1-10,13H;1-2H,(H,5,6)(H,7,8)/b;;2-1- |
| InChIKey | ASSKGMBGXDSYOY-KSBRXOFISA-N |
| XLogP | 4.34 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enedioic acid;bis(diphenylphosphane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enedioic acid;bis(diphenylphosphane)?
The IUPAC name of (Z)-but-2-enedioic acid;bis(diphenylphosphane) (CID 172683592) is (Z)-but-2-enedioic acid;bis(diphenylphosphane).
What is the SMILES notation for (Z)-but-2-enedioic acid;bis(diphenylphosphane)?
The canonical SMILES for (Z)-but-2-enedioic acid;bis(diphenylphosphane) is O=C(O)/C=C\C(=O)O.c1ccc(Pc2ccccc2)cc1.c1ccc(Pc2ccccc2)cc1.
What is the InChIKey of (Z)-but-2-enedioic acid;bis(diphenylphosphane)?
The InChIKey is ASSKGMBGXDSYOY-KSBRXOFISA-N. The full InChI is InChI=1S/2C12H11P.C4H4O4/c2*1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;5-3(6)1-2-4(7)8/h2*1-10,13H;1-2H,(H,5,6)(H,7,8)/b;;2-1-.
What are the key properties of (Z)-but-2-enedioic acid;bis(diphenylphosphane)?
(Z)-but-2-enedioic acid;bis(diphenylphosphane) has a molecular weight of 488.46 g/mol, XLogP of 4.34, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enedioic acid;bis(diphenylphosphane) is sourced from PubChem (CID 172683592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).