C20H17P — CID 18326967
bicyclo[2.2.2]octa-1,3,5,7-tetraene;diphenylphosphane (PubChem CID 18326967) has the molecular formula C20H17P and a molecular weight of 288.33 g/mol. Its IUPAC name is bicyclo[2.2.2]octa-1,3,5,7-tetraene;diphenylphosphane.
| Compound Name | bicyclo[2.2.2]octa-1,3,5,7-tetraene;diphenylphosphane |
|---|---|
| PubChem CID | 18326967 |
| Molecular Formula | C20H17P |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | bicyclo[2.2.2]octa-1,3,5,7-tetraene;diphenylphosphane |
| SMILES | c1cc2ccc1cc2.c1ccc(Pc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11P.C8H6/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-8-5-3-7(1)4-6-8/h1-10,13H;1-6H |
| InChIKey | ILEUMGRGIWJEMN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|