diphenylphosphane;phosphorous acid

C12H14O3P2 — CID 158763055

IUPACdiphenylphosphane;phosphorous acid
SMILESOP(O)O.c1ccc(Pc2ccccc2)cc1
InChIInChI=1S/C12H11P.H3O3P/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-4(2)3/h1-10,13H;1-3H
InChIKeyIOXJGKVXVSICMZ-UHFFFAOYSA-N
MW268.19 g/mol
LogP1.51
Rot. Bonds2

About diphenylphosphane;phosphorous acid

diphenylphosphane;phosphorous acid (PubChem CID 158763055) has the molecular formula C12H14O3P2 and a molecular weight of 268.19 g/mol. Its IUPAC name is diphenylphosphane;phosphorous acid.

Molecular Properties

Compound Namediphenylphosphane;phosphorous acid
PubChem CID158763055
Molecular FormulaC12H14O3P2
Molecular Weight268.19 g/mol
Exact Mass268.04
IUPAC Namediphenylphosphane;phosphorous acid
SMILESOP(O)O.c1ccc(Pc2ccccc2)cc1
InChIInChI=1S/C12H11P.H3O3P/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-4(2)3/h1-10,13H;1-3H
InChIKeyIOXJGKVXVSICMZ-UHFFFAOYSA-N
XLogP1.51
TPSA60.69 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.19
LogP ≤ 51.51
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze diphenylphosphane;phosphorous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of diphenylphosphane;phosphorous acid?
The IUPAC name of diphenylphosphane;phosphorous acid (CID 158763055) is diphenylphosphane;phosphorous acid.
What is the SMILES notation for diphenylphosphane;phosphorous acid?
The canonical SMILES for diphenylphosphane;phosphorous acid is OP(O)O.c1ccc(Pc2ccccc2)cc1.
What is the InChIKey of diphenylphosphane;phosphorous acid?
The InChIKey is IOXJGKVXVSICMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11P.H3O3P/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-4(2)3/h1-10,13H;1-3H.
What are the key properties of diphenylphosphane;phosphorous acid?
diphenylphosphane;phosphorous acid has a molecular weight of 268.19 g/mol, XLogP of 1.51, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylphosphane;phosphorous acid is sourced from PubChem (CID 158763055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).