About dichloromethane;diphenylphosphane
dichloromethane;diphenylphosphane (PubChem CID 158269242) has the molecular formula C13H13Cl2P
and a molecular weight of 271.13 g/mol. Its IUPAC name is dichloromethane;diphenylphosphane.
Molecular Properties
| Compound Name | dichloromethane;diphenylphosphane |
| PubChem CID | 158269242 |
| Molecular Formula | C13H13Cl2P |
| Molecular Weight | 271.13 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | dichloromethane;diphenylphosphane |
| SMILES | ClCCl.c1ccc(Pc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11P.CH2Cl2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2-1-3/h1-10,13H;1H2 |
| InChIKey | GIVBVAPPTUEILS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.13 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloromethane;diphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethane;diphenylphosphane?
The IUPAC name of dichloromethane;diphenylphosphane (CID 158269242) is dichloromethane;diphenylphosphane.
What is the SMILES notation for dichloromethane;diphenylphosphane?
The canonical SMILES for dichloromethane;diphenylphosphane is ClCCl.c1ccc(Pc2ccccc2)cc1.
What is the InChIKey of dichloromethane;diphenylphosphane?
The InChIKey is GIVBVAPPTUEILS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11P.CH2Cl2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2-1-3/h1-10,13H;1H2.
What are the key properties of dichloromethane;diphenylphosphane?
dichloromethane;diphenylphosphane has a molecular weight of 271.13 g/mol, XLogP of 3.74, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethane;diphenylphosphane is sourced from PubChem (CID 158269242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).