About butane;dichloronickel;diphenylphosphane
butane;dichloronickel;diphenylphosphane (PubChem CID 160852831) has the molecular formula C16H21Cl2NiP
and a molecular weight of 373.92 g/mol. Its IUPAC name is butane;dichloronickel;diphenylphosphane.
Molecular Properties
| Compound Name | butane;dichloronickel;diphenylphosphane |
| PubChem CID | 160852831 |
| Molecular Formula | C16H21Cl2NiP |
| Molecular Weight | 373.92 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | butane;dichloronickel;diphenylphosphane |
| SMILES | CCCC.Cl[Ni]Cl.c1ccc(Pc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11P.C4H10.2ClH.Ni/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-4-2;;;/h1-10,13H;3-4H2,1-2H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | SJMFIOVTMGJPEK-UHFFFAOYSA-L |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.92 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze butane;dichloronickel;diphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;dichloronickel;diphenylphosphane?
The IUPAC name of butane;dichloronickel;diphenylphosphane (CID 160852831) is butane;dichloronickel;diphenylphosphane.
What is the SMILES notation for butane;dichloronickel;diphenylphosphane?
The canonical SMILES for butane;dichloronickel;diphenylphosphane is CCCC.Cl[Ni]Cl.c1ccc(Pc2ccccc2)cc1.
What is the InChIKey of butane;dichloronickel;diphenylphosphane?
The InChIKey is SJMFIOVTMGJPEK-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H11P.C4H10.2ClH.Ni/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-4-2;;;/h1-10,13H;3-4H2,1-2H3;2*1H;/q;;;;+2/p-2.
What are the key properties of butane;dichloronickel;diphenylphosphane?
butane;dichloronickel;diphenylphosphane has a molecular weight of 373.92 g/mol, XLogP of 5.50, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butane;dichloronickel;diphenylphosphane is sourced from PubChem (CID 160852831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).