About diphenylphosphane;ethylphosphane
diphenylphosphane;ethylphosphane (PubChem CID 158116406) has the molecular formula C14H18P2
and a molecular weight of 248.25 g/mol. Its IUPAC name is diphenylphosphane;ethylphosphane.
Molecular Properties
| Compound Name | diphenylphosphane;ethylphosphane |
| PubChem CID | 158116406 |
| Molecular Formula | C14H18P2 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | diphenylphosphane;ethylphosphane |
| SMILES | CCP.c1ccc(Pc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11P.C2H7P/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-3/h1-10,13H;2-3H2,1H3 |
| InChIKey | FRBFMGAWWAEHQZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenylphosphane;ethylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylphosphane;ethylphosphane?
The IUPAC name of diphenylphosphane;ethylphosphane (CID 158116406) is diphenylphosphane;ethylphosphane.
What is the SMILES notation for diphenylphosphane;ethylphosphane?
The canonical SMILES for diphenylphosphane;ethylphosphane is CCP.c1ccc(Pc2ccccc2)cc1.
What is the InChIKey of diphenylphosphane;ethylphosphane?
The InChIKey is FRBFMGAWWAEHQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11P.C2H7P/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-3/h1-10,13H;2-3H2,1H3.
What are the key properties of diphenylphosphane;ethylphosphane?
diphenylphosphane;ethylphosphane has a molecular weight of 248.25 g/mol, XLogP of 3.20, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylphosphane;ethylphosphane is sourced from PubChem (CID 158116406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).