About bis(diphenylphosphane);zinc
bis(diphenylphosphane);zinc (PubChem CID 160732089) has the molecular formula C24H22P2Zn
and a molecular weight of 437.78 g/mol. Its IUPAC name is bis(diphenylphosphane);zinc.
Molecular Properties
| Compound Name | bis(diphenylphosphane);zinc |
| PubChem CID | 160732089 |
| Molecular Formula | C24H22P2Zn |
| Molecular Weight | 437.78 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | bis(diphenylphosphane);zinc |
| SMILES | [Zn].c1ccc(Pc2ccccc2)cc1.c1ccc(Pc2ccccc2)cc1 |
| InChI | InChI=1S/2C12H11P.Zn/c2*1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h2*1-10,13H; |
| InChIKey | RULXZDXHRDNNPQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.78 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(diphenylphosphane);zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(diphenylphosphane);zinc?
The IUPAC name of bis(diphenylphosphane);zinc (CID 160732089) is bis(diphenylphosphane);zinc.
What is the SMILES notation for bis(diphenylphosphane);zinc?
The canonical SMILES for bis(diphenylphosphane);zinc is [Zn].c1ccc(Pc2ccccc2)cc1.c1ccc(Pc2ccccc2)cc1.
What is the InChIKey of bis(diphenylphosphane);zinc?
The InChIKey is RULXZDXHRDNNPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H11P.Zn/c2*1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h2*1-10,13H;.
What are the key properties of bis(diphenylphosphane);zinc?
bis(diphenylphosphane);zinc has a molecular weight of 437.78 g/mol, XLogP of 4.63, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(diphenylphosphane);zinc is sourced from PubChem (CID 160732089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).