About dichloropalladium;diphenylphosphane;iron
dichloropalladium;diphenylphosphane;iron (PubChem CID 175532989) has the molecular formula C12H11Cl2FePPd
and a molecular weight of 419.37 g/mol. Its IUPAC name is dichloropalladium;diphenylphosphane;iron.
Molecular Properties
| Compound Name | dichloropalladium;diphenylphosphane;iron |
| PubChem CID | 175532989 |
| Molecular Formula | C12H11Cl2FePPd |
| Molecular Weight | 419.37 g/mol |
| Exact Mass | 417.84 |
| IUPAC Name | dichloropalladium;diphenylphosphane;iron |
| SMILES | Cl[Pd]Cl.[Fe].c1ccc(Pc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11P.2ClH.Fe.Pd/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;;;/h1-10,13H;2*1H;;/q;;;;+2/p-2 |
| InChIKey | HXOCXWRYBRFCIV-UHFFFAOYSA-L |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloropalladium;diphenylphosphane;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloropalladium;diphenylphosphane;iron?
The IUPAC name of dichloropalladium;diphenylphosphane;iron (CID 175532989) is dichloropalladium;diphenylphosphane;iron.
What is the SMILES notation for dichloropalladium;diphenylphosphane;iron?
The canonical SMILES for dichloropalladium;diphenylphosphane;iron is Cl[Pd]Cl.[Fe].c1ccc(Pc2ccccc2)cc1.
What is the InChIKey of dichloropalladium;diphenylphosphane;iron?
The InChIKey is HXOCXWRYBRFCIV-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H11P.2ClH.Fe.Pd/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;;;/h1-10,13H;2*1H;;/q;;;;+2/p-2.
What are the key properties of dichloropalladium;diphenylphosphane;iron?
dichloropalladium;diphenylphosphane;iron has a molecular weight of 419.37 g/mol, XLogP of 3.69, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloropalladium;diphenylphosphane;iron is sourced from PubChem (CID 175532989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).