About diphenylphosphane;trichlororuthenium
diphenylphosphane;trichlororuthenium (PubChem CID 162065304) has the molecular formula C12H11Cl3PRu
and a molecular weight of 393.62 g/mol. Its IUPAC name is diphenylphosphane;trichlororuthenium.
Molecular Properties
| Compound Name | diphenylphosphane;trichlororuthenium |
| PubChem CID | 162065304 |
| Molecular Formula | C12H11Cl3PRu |
| Molecular Weight | 393.62 g/mol |
| Exact Mass | 392.87 |
| IUPAC Name | diphenylphosphane;trichlororuthenium |
| SMILES | Cl[Ru](Cl)Cl.c1ccc(Pc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11P.3ClH.Ru/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;;;/h1-10,13H;3*1H;/q;;;;+3/p-3 |
| InChIKey | ZAJNBMTWXQCWDX-UHFFFAOYSA-K |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.62 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenylphosphane;trichlororuthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylphosphane;trichlororuthenium?
The IUPAC name of diphenylphosphane;trichlororuthenium (CID 162065304) is diphenylphosphane;trichlororuthenium.
What is the SMILES notation for diphenylphosphane;trichlororuthenium?
The canonical SMILES for diphenylphosphane;trichlororuthenium is Cl[Ru](Cl)Cl.c1ccc(Pc2ccccc2)cc1.
What is the InChIKey of diphenylphosphane;trichlororuthenium?
The InChIKey is ZAJNBMTWXQCWDX-UHFFFAOYSA-K. The full InChI is InChI=1S/C12H11P.3ClH.Ru/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;;;/h1-10,13H;3*1H;/q;;;;+3/p-3.
What are the key properties of diphenylphosphane;trichlororuthenium?
diphenylphosphane;trichlororuthenium has a molecular weight of 393.62 g/mol, XLogP of 4.38, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylphosphane;trichlororuthenium is sourced from PubChem (CID 162065304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).