About diphenylphosphane;octane
diphenylphosphane;octane (PubChem CID 19797985) has the molecular formula C20H29P
and a molecular weight of 300.43 g/mol. Its IUPAC name is diphenylphosphane;octane.
Molecular Properties
| Compound Name | diphenylphosphane;octane |
| PubChem CID | 19797985 |
| Molecular Formula | C20H29P |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | diphenylphosphane;octane |
| SMILES | CCCCCCCC.c1ccc(Pc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11P.C8H18/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-5-7-8-6-4-2/h1-10,13H;3-8H2,1-2H3 |
| InChIKey | AJJZBOFUSXFCSG-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenylphosphane;octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylphosphane;octane?
The IUPAC name of diphenylphosphane;octane (CID 19797985) is diphenylphosphane;octane.
What is the SMILES notation for diphenylphosphane;octane?
The canonical SMILES for diphenylphosphane;octane is CCCCCCCC.c1ccc(Pc2ccccc2)cc1.
What is the InChIKey of diphenylphosphane;octane?
The InChIKey is AJJZBOFUSXFCSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11P.C8H18/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-5-7-8-6-4-2/h1-10,13H;3-8H2,1-2H3.
What are the key properties of diphenylphosphane;octane?
diphenylphosphane;octane has a molecular weight of 300.43 g/mol, XLogP of 5.68, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylphosphane;octane is sourced from PubChem (CID 19797985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).