About diphenylphosphane;toluene;hydrochloride
diphenylphosphane;toluene;hydrochloride (PubChem CID 174856667) has the molecular formula C19H20ClP
and a molecular weight of 314.80 g/mol. Its IUPAC name is diphenylphosphane;toluene;hydrochloride.
Molecular Properties
| Compound Name | diphenylphosphane;toluene;hydrochloride |
| PubChem CID | 174856667 |
| Molecular Formula | C19H20ClP |
| Molecular Weight | 314.80 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | diphenylphosphane;toluene;hydrochloride |
| SMILES | Cc1ccccc1.Cl.c1ccc(Pc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11P.C7H8.ClH/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-7-5-3-2-4-6-7;/h1-10,13H;2-6H,1H3;1H |
| InChIKey | DJPXMZXEYDFAQE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.80 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenylphosphane;toluene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylphosphane;toluene;hydrochloride?
The IUPAC name of diphenylphosphane;toluene;hydrochloride (CID 174856667) is diphenylphosphane;toluene;hydrochloride.
What is the SMILES notation for diphenylphosphane;toluene;hydrochloride?
The canonical SMILES for diphenylphosphane;toluene;hydrochloride is Cc1ccccc1.Cl.c1ccc(Pc2ccccc2)cc1.
What is the InChIKey of diphenylphosphane;toluene;hydrochloride?
The InChIKey is DJPXMZXEYDFAQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11P.C7H8.ClH/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-7-5-3-2-4-6-7;/h1-10,13H;2-6H,1H3;1H.
What are the key properties of diphenylphosphane;toluene;hydrochloride?
diphenylphosphane;toluene;hydrochloride has a molecular weight of 314.80 g/mol, XLogP of 4.73, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylphosphane;toluene;hydrochloride is sourced from PubChem (CID 174856667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).