C19H17O2P — CID 174619172
bicyclo[2.2.0]hexa-1,3,5-triene;diphenylphosphane;formic acid (PubChem CID 174619172) has the molecular formula C19H17O2P and a molecular weight of 308.32 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-triene;diphenylphosphane;formic acid.
| Compound Name | bicyclo[2.2.0]hexa-1,3,5-triene;diphenylphosphane;formic acid |
|---|---|
| PubChem CID | 174619172 |
| Molecular Formula | C19H17O2P |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,3,5-triene;diphenylphosphane;formic acid |
| SMILES | O=CO.c1cc2ccc1-2.c1ccc(Pc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11P.C6H4.CH2O2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-6-4-3-5(1)6;2-1-3/h1-10,13H;1-4H;1H,(H,2,3) |
| InChIKey | MSBSJNDQJDDLIZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|