About butanedioate;bis(quinolin-1-ium)
butanedioate;bis(quinolin-1-ium) (PubChem CID 11538076) has the molecular formula C22H20N2O4
and a molecular weight of 376.41 g/mol. Its IUPAC name is butanedioate;bis(quinolin-1-ium).
Molecular Properties
| Compound Name | butanedioate;bis(quinolin-1-ium) |
| PubChem CID | 11538076 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | butanedioate;bis(quinolin-1-ium) |
| SMILES | O=C([O-])CCC(=O)[O-].c1ccc2[nH+]cccc2c1.c1ccc2[nH+]cccc2c1 |
| InChI | InChI=1S/2C9H7N.C4H6O4/c2*1-2-6-9-8(4-1)5-3-7-10-9;5-3(6)1-2-4(7)8/h2*1-7H;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | MGWWWPBRCLEQJX-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 108.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze butanedioate;bis(quinolin-1-ium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanedioate;bis(quinolin-1-ium)?
The IUPAC name of butanedioate;bis(quinolin-1-ium) (CID 11538076) is butanedioate;bis(quinolin-1-ium).
What is the SMILES notation for butanedioate;bis(quinolin-1-ium)?
The canonical SMILES for butanedioate;bis(quinolin-1-ium) is O=C([O-])CCC(=O)[O-].c1ccc2[nH+]cccc2c1.c1ccc2[nH+]cccc2c1.
What is the InChIKey of butanedioate;bis(quinolin-1-ium)?
The InChIKey is MGWWWPBRCLEQJX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H7N.C4H6O4/c2*1-2-6-9-8(4-1)5-3-7-10-9;5-3(6)1-2-4(7)8/h2*1-7H;1-2H2,(H,5,6)(H,7,8).
What are the key properties of butanedioate;bis(quinolin-1-ium)?
butanedioate;bis(quinolin-1-ium) has a molecular weight of 376.41 g/mol, XLogP of 0.57, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butanedioate;bis(quinolin-1-ium) is sourced from PubChem (CID 11538076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).