About hexanedioate;bis(pyridin-1-ium-2-amine)
hexanedioate;bis(pyridin-1-ium-2-amine) (PubChem CID 166624740) has the molecular formula C16H22N4O4
and a molecular weight of 334.38 g/mol. Its IUPAC name is hexanedioate;bis(pyridin-1-ium-2-amine).
Molecular Properties
| Compound Name | hexanedioate;bis(pyridin-1-ium-2-amine) |
| PubChem CID | 166624740 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | hexanedioate;bis(pyridin-1-ium-2-amine) |
| SMILES | Nc1cccc[nH+]1.Nc1cccc[nH+]1.O=C([O-])CCCCC(=O)[O-] |
| InChI | InChI=1S/C6H10O4.2C5H6N2/c7-5(8)3-1-2-4-6(9)10;2*6-5-3-1-2-4-7-5/h1-4H2,(H,7,8)(H,9,10);2*1-4H,(H2,6,7) |
| InChIKey | YWWAVOMPHFASBK-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 160.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexanedioate;bis(pyridin-1-ium-2-amine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexanedioate;bis(pyridin-1-ium-2-amine)?
The IUPAC name of hexanedioate;bis(pyridin-1-ium-2-amine) (CID 166624740) is hexanedioate;bis(pyridin-1-ium-2-amine).
What is the SMILES notation for hexanedioate;bis(pyridin-1-ium-2-amine)?
The canonical SMILES for hexanedioate;bis(pyridin-1-ium-2-amine) is Nc1cccc[nH+]1.Nc1cccc[nH+]1.O=C([O-])CCCCC(=O)[O-].
What is the InChIKey of hexanedioate;bis(pyridin-1-ium-2-amine)?
The InChIKey is YWWAVOMPHFASBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4.2C5H6N2/c7-5(8)3-1-2-4-6(9)10;2*6-5-3-1-2-4-7-5/h1-4H2,(H,7,8)(H,9,10);2*1-4H,(H2,6,7).
What are the key properties of hexanedioate;bis(pyridin-1-ium-2-amine)?
hexanedioate;bis(pyridin-1-ium-2-amine) has a molecular weight of 334.38 g/mol, XLogP of -1.79, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for hexanedioate;bis(pyridin-1-ium-2-amine) is sourced from PubChem (CID 166624740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).