About decanedioate;bis(tin(4+));benzoate
decanedioate;bis(tin(4+));benzoate (PubChem CID 160634216) has the molecular formula C17H21O6Sn2+5
and a molecular weight of 558.77 g/mol. Its IUPAC name is decanedioate;bis(tin(4+));benzoate.
Molecular Properties
| Compound Name | decanedioate;bis(tin(4+));benzoate |
| PubChem CID | 160634216 |
| Molecular Formula | C17H21O6Sn2+5 |
| Molecular Weight | 558.77 g/mol |
| Exact Mass | 560.94 |
| IUPAC Name | decanedioate;bis(tin(4+));benzoate |
| SMILES | O=C([O-])CCCCCCCCC(=O)[O-].O=C([O-])c1ccccc1.[Sn+4].[Sn+4] |
| InChI | InChI=1S/C10H18O4.C7H6O2.2Sn/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;8-7(9)6-4-2-1-3-5-6;;/h1-8H2,(H,11,12)(H,13,14);1-5H,(H,8,9);;/q;;2*+4/p-3 |
| InChIKey | RIIBKKOOBZVGPV-UHFFFAOYSA-K |
| XLogP | -1.10 |
| TPSA | 120.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 558.77 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decanedioate;bis(tin(4+));benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decanedioate;bis(tin(4+));benzoate?
The IUPAC name of decanedioate;bis(tin(4+));benzoate (CID 160634216) is decanedioate;bis(tin(4+));benzoate.
What is the SMILES notation for decanedioate;bis(tin(4+));benzoate?
The canonical SMILES for decanedioate;bis(tin(4+));benzoate is O=C([O-])CCCCCCCCC(=O)[O-].O=C([O-])c1ccccc1.[Sn+4].[Sn+4].
What is the InChIKey of decanedioate;bis(tin(4+));benzoate?
The InChIKey is RIIBKKOOBZVGPV-UHFFFAOYSA-K. The full InChI is InChI=1S/C10H18O4.C7H6O2.2Sn/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;8-7(9)6-4-2-1-3-5-6;;/h1-8H2,(H,11,12)(H,13,14);1-5H,(H,8,9);;/q;;2*+4/p-3.
What are the key properties of decanedioate;bis(tin(4+));benzoate?
decanedioate;bis(tin(4+));benzoate has a molecular weight of 558.77 g/mol, XLogP of -1.10, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for decanedioate;bis(tin(4+));benzoate is sourced from PubChem (CID 160634216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).