About triazanium;hexanedioate;benzoate
triazanium;hexanedioate;benzoate (PubChem CID 178053899) has the molecular formula C13H25N3O6
and a molecular weight of 319.36 g/mol. Its IUPAC name is triazanium;hexanedioate;benzoate.
Molecular Properties
| Compound Name | triazanium;hexanedioate;benzoate |
| PubChem CID | 178053899 |
| Molecular Formula | C13H25N3O6 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | triazanium;hexanedioate;benzoate |
| SMILES | O=C([O-])CCCCC(=O)[O-].O=C([O-])c1ccccc1.[NH4+].[NH4+].[NH4+] |
| InChI | InChI=1S/C7H6O2.C6H10O4.3H3N/c8-7(9)6-4-2-1-3-5-6;7-5(8)3-1-2-4-6(9)10;;;/h1-5H,(H,8,9);1-4H2,(H,7,8)(H,9,10);3*1H3 |
| InChIKey | WBHIHIJPZKVBHK-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 229.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze triazanium;hexanedioate;benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triazanium;hexanedioate;benzoate?
The IUPAC name of triazanium;hexanedioate;benzoate (CID 178053899) is triazanium;hexanedioate;benzoate.
What is the SMILES notation for triazanium;hexanedioate;benzoate?
The canonical SMILES for triazanium;hexanedioate;benzoate is O=C([O-])CCCCC(=O)[O-].O=C([O-])c1ccccc1.[NH4+].[NH4+].[NH4+].
What is the InChIKey of triazanium;hexanedioate;benzoate?
The InChIKey is WBHIHIJPZKVBHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C6H10O4.3H3N/c8-7(9)6-4-2-1-3-5-6;7-5(8)3-1-2-4-6(9)10;;;/h1-5H,(H,8,9);1-4H2,(H,7,8)(H,9,10);3*1H3.
What are the key properties of triazanium;hexanedioate;benzoate?
triazanium;hexanedioate;benzoate has a molecular weight of 319.36 g/mol, XLogP of -0.77, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for triazanium;hexanedioate;benzoate is sourced from PubChem (CID 178053899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).