About potassium 15-phenylpentadecanoate
potassium 15-phenylpentadecanoate (PubChem CID 23717018) has the molecular formula C21H33KO2
and a molecular weight of 356.59 g/mol. Its IUPAC name is potassium 15-phenylpentadecanoate.
Molecular Properties
| Compound Name | potassium 15-phenylpentadecanoate |
| PubChem CID | 23717018 |
| Molecular Formula | C21H33KO2 |
| Molecular Weight | 356.59 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | potassium 15-phenylpentadecanoate |
| SMILES | O=C([O-])CCCCCCCCCCCCCCc1ccccc1.[K+] |
| InChI | InChI=1S/C21H34O2.K/c22-21(23)19-15-10-8-6-4-2-1-3-5-7-9-12-16-20-17-13-11-14-18-20;/h11,13-14,17-18H,1-10,12,15-16,19H2,(H,22,23);/q;+1/p-1 |
| InChIKey | AEZGWOKIPQJJLM-UHFFFAOYSA-M |
| XLogP | 2.05 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.59 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze potassium 15-phenylpentadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 15-phenylpentadecanoate?
The IUPAC name of potassium 15-phenylpentadecanoate (CID 23717018) is potassium 15-phenylpentadecanoate.
What is the SMILES notation for potassium 15-phenylpentadecanoate?
The canonical SMILES for potassium 15-phenylpentadecanoate is O=C([O-])CCCCCCCCCCCCCCc1ccccc1.[K+].
What is the InChIKey of potassium 15-phenylpentadecanoate?
The InChIKey is AEZGWOKIPQJJLM-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H34O2.K/c22-21(23)19-15-10-8-6-4-2-1-3-5-7-9-12-16-20-17-13-11-14-18-20;/h11,13-14,17-18H,1-10,12,15-16,19H2,(H,22,23);/q;+1/p-1.
What are the key properties of potassium 15-phenylpentadecanoate?
potassium 15-phenylpentadecanoate has a molecular weight of 356.59 g/mol, XLogP of 2.05, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 15-phenylpentadecanoate is sourced from PubChem (CID 23717018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).