About sodium 8-phenyloctaneselenoate
sodium 8-phenyloctaneselenoate (PubChem CID 141480312) has the molecular formula C14H19NaOSe
and a molecular weight of 305.25 g/mol. Its IUPAC name is sodium 8-phenyloctaneselenoate.
Molecular Properties
| Compound Name | sodium 8-phenyloctaneselenoate |
| PubChem CID | 141480312 |
| Molecular Formula | C14H19NaOSe |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | sodium 8-phenyloctaneselenoate |
| SMILES | [Na+].[O-]C(=[Se])CCCCCCCc1ccccc1 |
| InChI | InChI=1S/C14H20OSe.Na/c15-14(16)12-8-3-1-2-5-9-13-10-6-4-7-11-13;/h4,6-7,10-11H,1-3,5,8-9,12H2,(H,15,16);/q;+1/p-1 |
| InChIKey | RMZFLCQLHQCDRH-UHFFFAOYSA-M |
| XLogP | -0.77 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium 8-phenyloctaneselenoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 8-phenyloctaneselenoate?
The IUPAC name of sodium 8-phenyloctaneselenoate (CID 141480312) is sodium 8-phenyloctaneselenoate.
What is the SMILES notation for sodium 8-phenyloctaneselenoate?
The canonical SMILES for sodium 8-phenyloctaneselenoate is [Na+].[O-]C(=[Se])CCCCCCCc1ccccc1.
What is the InChIKey of sodium 8-phenyloctaneselenoate?
The InChIKey is RMZFLCQLHQCDRH-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H20OSe.Na/c15-14(16)12-8-3-1-2-5-9-13-10-6-4-7-11-13;/h4,6-7,10-11H,1-3,5,8-9,12H2,(H,15,16);/q;+1/p-1.
What are the key properties of sodium 8-phenyloctaneselenoate?
sodium 8-phenyloctaneselenoate has a molecular weight of 305.25 g/mol, XLogP of -0.77, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 8-phenyloctaneselenoate is sourced from PubChem (CID 141480312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).