About 3-carboxybenzoate;pyridin-1-ium-2-amine
3-carboxybenzoate;pyridin-1-ium-2-amine (PubChem CID 139145655) has the molecular formula C13H12N2O4
and a molecular weight of 260.25 g/mol. Its IUPAC name is 3-carboxybenzoate;pyridin-1-ium-2-amine.
Molecular Properties
| Compound Name | 3-carboxybenzoate;pyridin-1-ium-2-amine |
| PubChem CID | 139145655 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 3-carboxybenzoate;pyridin-1-ium-2-amine |
| SMILES | Nc1cccc[nH+]1.O=C([O-])c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C8H6O4.C5H6N2/c9-7(10)5-2-1-3-6(4-5)8(11)12;6-5-3-1-2-4-7-5/h1-4H,(H,9,10)(H,11,12);1-4H,(H2,6,7) |
| InChIKey | HPHQWVISMHEHCN-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-carboxybenzoate;pyridin-1-ium-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-carboxybenzoate;pyridin-1-ium-2-amine?
The IUPAC name of 3-carboxybenzoate;pyridin-1-ium-2-amine (CID 139145655) is 3-carboxybenzoate;pyridin-1-ium-2-amine.
What is the SMILES notation for 3-carboxybenzoate;pyridin-1-ium-2-amine?
The canonical SMILES for 3-carboxybenzoate;pyridin-1-ium-2-amine is Nc1cccc[nH+]1.O=C([O-])c1cccc(C(=O)O)c1.
What is the InChIKey of 3-carboxybenzoate;pyridin-1-ium-2-amine?
The InChIKey is HPHQWVISMHEHCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4.C5H6N2/c9-7(10)5-2-1-3-6(4-5)8(11)12;6-5-3-1-2-4-7-5/h1-4H,(H,9,10)(H,11,12);1-4H,(H2,6,7).
What are the key properties of 3-carboxybenzoate;pyridin-1-ium-2-amine?
3-carboxybenzoate;pyridin-1-ium-2-amine has a molecular weight of 260.25 g/mol, XLogP of -0.17, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-carboxybenzoate;pyridin-1-ium-2-amine is sourced from PubChem (CID 139145655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).