About methanesulfonate;quinolin-1-ium
methanesulfonate;quinolin-1-ium (PubChem CID 11521445) has the molecular formula C10H11NO3S
and a molecular weight of 225.27 g/mol. Its IUPAC name is methanesulfonate;quinolin-1-ium.
Molecular Properties
| Compound Name | methanesulfonate;quinolin-1-ium |
| PubChem CID | 11521445 |
| Molecular Formula | C10H11NO3S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | methanesulfonate;quinolin-1-ium |
| SMILES | CS(=O)(=O)[O-].c1ccc2[nH+]cccc2c1 |
| InChI | InChI=1S/C9H7N.CH4O3S/c1-2-6-9-8(4-1)5-3-7-10-9;1-5(2,3)4/h1-7H;1H3,(H,2,3,4) |
| InChIKey | QDZPEBUZOMOUNJ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 71.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonate;quinolin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonate;quinolin-1-ium?
The IUPAC name of methanesulfonate;quinolin-1-ium (CID 11521445) is methanesulfonate;quinolin-1-ium.
What is the SMILES notation for methanesulfonate;quinolin-1-ium?
The canonical SMILES for methanesulfonate;quinolin-1-ium is CS(=O)(=O)[O-].c1ccc2[nH+]cccc2c1.
What is the InChIKey of methanesulfonate;quinolin-1-ium?
The InChIKey is QDZPEBUZOMOUNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.CH4O3S/c1-2-6-9-8(4-1)5-3-7-10-9;1-5(2,3)4/h1-7H;1H3,(H,2,3,4).
What are the key properties of methanesulfonate;quinolin-1-ium?
methanesulfonate;quinolin-1-ium has a molecular weight of 225.27 g/mol, XLogP of 0.82, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonate;quinolin-1-ium is sourced from PubChem (CID 11521445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).