About calcium;naphthalene;sulfate
calcium;naphthalene;sulfate (PubChem CID 158920591) has the molecular formula C10H8CaO4S
and a molecular weight of 264.31 g/mol. Its IUPAC name is calcium;naphthalene;sulfate.
Molecular Properties
| Compound Name | calcium;naphthalene;sulfate |
| PubChem CID | 158920591 |
| Molecular Formula | C10H8CaO4S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 263.98 |
| IUPAC Name | calcium;naphthalene;sulfate |
| SMILES | O=S(=O)([O-])[O-].[Ca+2].c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.Ca.H2O4S/c1-2-6-10-8-4-3-7-9(10)5-1;;1-5(2,3)4/h1-8H;;(H2,1,2,3,4)/q;+2;/p-2 |
| InChIKey | JHUAIEYWHXWBMP-UHFFFAOYSA-L |
| XLogP | 1.12 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze calcium;naphthalene;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;naphthalene;sulfate?
The IUPAC name of calcium;naphthalene;sulfate (CID 158920591) is calcium;naphthalene;sulfate.
What is the SMILES notation for calcium;naphthalene;sulfate?
The canonical SMILES for calcium;naphthalene;sulfate is O=S(=O)([O-])[O-].[Ca+2].c1ccc2ccccc2c1.
What is the InChIKey of calcium;naphthalene;sulfate?
The InChIKey is JHUAIEYWHXWBMP-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H8.Ca.H2O4S/c1-2-6-10-8-4-3-7-9(10)5-1;;1-5(2,3)4/h1-8H;;(H2,1,2,3,4)/q;+2;/p-2.
What are the key properties of calcium;naphthalene;sulfate?
calcium;naphthalene;sulfate has a molecular weight of 264.31 g/mol, XLogP of 1.12, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;naphthalene;sulfate is sourced from PubChem (CID 158920591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).