About dipotassium;naphthalene;sulfate
dipotassium;naphthalene;sulfate (PubChem CID 159561982) has the molecular formula C10H8K2O4S
and a molecular weight of 302.43 g/mol. Its IUPAC name is dipotassium;naphthalene;sulfate.
Molecular Properties
| Compound Name | dipotassium;naphthalene;sulfate |
| PubChem CID | 159561982 |
| Molecular Formula | C10H8K2O4S |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 301.94 |
| IUPAC Name | dipotassium;naphthalene;sulfate |
| SMILES | O=S(=O)([O-])[O-].[K+].[K+].c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.2K.H2O4S/c1-2-6-10-8-4-3-7-9(10)5-1;;;1-5(2,3)4/h1-8H;;;(H2,1,2,3,4)/q;2*+1;/p-2 |
| InChIKey | MGSVCRWSGAOVDJ-UHFFFAOYSA-L |
| XLogP | -4.49 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | -4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;naphthalene;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;naphthalene;sulfate?
The IUPAC name of dipotassium;naphthalene;sulfate (CID 159561982) is dipotassium;naphthalene;sulfate.
What is the SMILES notation for dipotassium;naphthalene;sulfate?
The canonical SMILES for dipotassium;naphthalene;sulfate is O=S(=O)([O-])[O-].[K+].[K+].c1ccc2ccccc2c1.
What is the InChIKey of dipotassium;naphthalene;sulfate?
The InChIKey is MGSVCRWSGAOVDJ-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H8.2K.H2O4S/c1-2-6-10-8-4-3-7-9(10)5-1;;;1-5(2,3)4/h1-8H;;;(H2,1,2,3,4)/q;2*+1;/p-2.
What are the key properties of dipotassium;naphthalene;sulfate?
dipotassium;naphthalene;sulfate has a molecular weight of 302.43 g/mol, XLogP of -4.49, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;naphthalene;sulfate is sourced from PubChem (CID 159561982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).