About ethane;methanesulfonate;naphthalene
ethane;methanesulfonate;naphthalene (PubChem CID 91264574) has the molecular formula C13H17O3S-
and a molecular weight of 253.34 g/mol. Its IUPAC name is ethane;methanesulfonate;naphthalene.
Molecular Properties
| Compound Name | ethane;methanesulfonate;naphthalene |
| PubChem CID | 91264574 |
| Molecular Formula | C13H17O3S- |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | ethane;methanesulfonate;naphthalene |
| SMILES | CC.CS(=O)(=O)[O-].c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C2H6.CH4O3S/c1-2-6-10-8-4-3-7-9(10)5-1;1-2;1-5(2,3)4/h1-8H;1-2H3;1H3,(H,2,3,4)/p-1 |
| InChIKey | KIGHPQJJGFCARW-UHFFFAOYSA-M |
| XLogP | 3.03 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;methanesulfonate;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanesulfonate;naphthalene?
The IUPAC name of ethane;methanesulfonate;naphthalene (CID 91264574) is ethane;methanesulfonate;naphthalene.
What is the SMILES notation for ethane;methanesulfonate;naphthalene?
The canonical SMILES for ethane;methanesulfonate;naphthalene is CC.CS(=O)(=O)[O-].c1ccc2ccccc2c1.
What is the InChIKey of ethane;methanesulfonate;naphthalene?
The InChIKey is KIGHPQJJGFCARW-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H8.C2H6.CH4O3S/c1-2-6-10-8-4-3-7-9(10)5-1;1-2;1-5(2,3)4/h1-8H;1-2H3;1H3,(H,2,3,4)/p-1.
What are the key properties of ethane;methanesulfonate;naphthalene?
ethane;methanesulfonate;naphthalene has a molecular weight of 253.34 g/mol, XLogP of 3.03, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanesulfonate;naphthalene is sourced from PubChem (CID 91264574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).