About benzene;ethane;methanesulfonate
benzene;ethane;methanesulfonate (PubChem CID 90804134) has the molecular formula C9H15O3S-
and a molecular weight of 203.28 g/mol. Its IUPAC name is benzene;ethane;methanesulfonate.
Molecular Properties
| Compound Name | benzene;ethane;methanesulfonate |
| PubChem CID | 90804134 |
| Molecular Formula | C9H15O3S- |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | benzene;ethane;methanesulfonate |
| SMILES | CC.CS(=O)(=O)[O-].c1ccccc1 |
| InChI | InChI=1S/C6H6.C2H6.CH4O3S/c1-2-4-6-5-3-1;1-2;1-5(2,3)4/h1-6H;1-2H3;1H3,(H,2,3,4)/p-1 |
| InChIKey | LKXGMKGTEZYHNL-UHFFFAOYSA-M |
| XLogP | 1.87 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze benzene;ethane;methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;ethane;methanesulfonate?
The IUPAC name of benzene;ethane;methanesulfonate (CID 90804134) is benzene;ethane;methanesulfonate.
What is the SMILES notation for benzene;ethane;methanesulfonate?
The canonical SMILES for benzene;ethane;methanesulfonate is CC.CS(=O)(=O)[O-].c1ccccc1.
What is the InChIKey of benzene;ethane;methanesulfonate?
The InChIKey is LKXGMKGTEZYHNL-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6.C2H6.CH4O3S/c1-2-4-6-5-3-1;1-2;1-5(2,3)4/h1-6H;1-2H3;1H3,(H,2,3,4)/p-1.
What are the key properties of benzene;ethane;methanesulfonate?
benzene;ethane;methanesulfonate has a molecular weight of 203.28 g/mol, XLogP of 1.87, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;ethane;methanesulfonate is sourced from PubChem (CID 90804134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).