About methanesulfonate;silver
methanesulfonate;silver (PubChem CID 15907847) has the molecular formula C2H6AgO6S2-2
and a molecular weight of 298.07 g/mol. Its IUPAC name is methanesulfonate;silver.
Molecular Properties
| Compound Name | methanesulfonate;silver |
| PubChem CID | 15907847 |
| Molecular Formula | C2H6AgO6S2-2 |
| Molecular Weight | 298.07 g/mol |
| Exact Mass | 296.87 |
| IUPAC Name | methanesulfonate;silver |
| SMILES | CS(=O)(=O)[O-].CS(=O)(=O)[O-].[Ag] |
| InChI | InChI=1S/2CH4O3S.Ag/c2*1-5(2,3)4;/h2*1H3,(H,2,3,4);/p-2 |
| InChIKey | IHBLKVFTAMBLOU-UHFFFAOYSA-L |
| XLogP | -1.68 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.07 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonate;silver with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonate;silver?
The IUPAC name of methanesulfonate;silver (CID 15907847) is methanesulfonate;silver.
What is the SMILES notation for methanesulfonate;silver?
The canonical SMILES for methanesulfonate;silver is CS(=O)(=O)[O-].CS(=O)(=O)[O-].[Ag].
What is the InChIKey of methanesulfonate;silver?
The InChIKey is IHBLKVFTAMBLOU-UHFFFAOYSA-L. The full InChI is InChI=1S/2CH4O3S.Ag/c2*1-5(2,3)4;/h2*1H3,(H,2,3,4);/p-2.
What are the key properties of methanesulfonate;silver?
methanesulfonate;silver has a molecular weight of 298.07 g/mol, XLogP of -1.68, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonate;silver is sourced from PubChem (CID 15907847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).