About cadmium(2+);methanesulfonate
cadmium(2+);methanesulfonate (PubChem CID 15443099) has the molecular formula C2H6CdO6S2
and a molecular weight of 302.61 g/mol. Its IUPAC name is cadmium(2+);methanesulfonate.
Molecular Properties
| Compound Name | cadmium(2+);methanesulfonate |
| PubChem CID | 15443099 |
| Molecular Formula | C2H6CdO6S2 |
| Molecular Weight | 302.61 g/mol |
| Exact Mass | 303.86 |
| IUPAC Name | cadmium(2+);methanesulfonate |
| SMILES | CS(=O)(=O)[O-].CS(=O)(=O)[O-].[Cd+2] |
| InChI | InChI=1S/2CH4O3S.Cd/c2*1-5(2,3)4;/h2*1H3,(H,2,3,4);/q;;+2/p-2 |
| InChIKey | ZTUWUPQUKQVYLH-UHFFFAOYSA-L |
| XLogP | -1.68 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.61 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze cadmium(2+);methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium(2+);methanesulfonate?
The IUPAC name of cadmium(2+);methanesulfonate (CID 15443099) is cadmium(2+);methanesulfonate.
What is the SMILES notation for cadmium(2+);methanesulfonate?
The canonical SMILES for cadmium(2+);methanesulfonate is CS(=O)(=O)[O-].CS(=O)(=O)[O-].[Cd+2].
What is the InChIKey of cadmium(2+);methanesulfonate?
The InChIKey is ZTUWUPQUKQVYLH-UHFFFAOYSA-L. The full InChI is InChI=1S/2CH4O3S.Cd/c2*1-5(2,3)4;/h2*1H3,(H,2,3,4);/q;;+2/p-2.
What are the key properties of cadmium(2+);methanesulfonate?
cadmium(2+);methanesulfonate has a molecular weight of 302.61 g/mol, XLogP of -1.68, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium(2+);methanesulfonate is sourced from PubChem (CID 15443099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).