About lithium;methanesulfonate;trifluoroborane
lithium;methanesulfonate;trifluoroborane (PubChem CID 172736333) has the molecular formula CH3BF3LiO3S
and a molecular weight of 169.85 g/mol. Its IUPAC name is lithium;methanesulfonate;trifluoroborane.
Molecular Properties
| Compound Name | lithium;methanesulfonate;trifluoroborane |
| PubChem CID | 172736333 |
| Molecular Formula | CH3BF3LiO3S |
| Molecular Weight | 169.85 g/mol |
| Exact Mass | 170.00 |
| IUPAC Name | lithium;methanesulfonate;trifluoroborane |
| SMILES | CS(=O)(=O)[O-].FB(F)F.[Li+] |
| InChI | InChI=1S/CH4O3S.BF3.Li/c1-5(2,3)4;2-1(3)4;/h1H3,(H,2,3,4);;/q;;+1/p-1 |
| InChIKey | IMKBXGRAQOWAFU-UHFFFAOYSA-M |
| XLogP | -2.95 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.85 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze lithium;methanesulfonate;trifluoroborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;methanesulfonate;trifluoroborane?
The IUPAC name of lithium;methanesulfonate;trifluoroborane (CID 172736333) is lithium;methanesulfonate;trifluoroborane.
What is the SMILES notation for lithium;methanesulfonate;trifluoroborane?
The canonical SMILES for lithium;methanesulfonate;trifluoroborane is CS(=O)(=O)[O-].FB(F)F.[Li+].
What is the InChIKey of lithium;methanesulfonate;trifluoroborane?
The InChIKey is IMKBXGRAQOWAFU-UHFFFAOYSA-M. The full InChI is InChI=1S/CH4O3S.BF3.Li/c1-5(2,3)4;2-1(3)4;/h1H3,(H,2,3,4);;/q;;+1/p-1.
What are the key properties of lithium;methanesulfonate;trifluoroborane?
lithium;methanesulfonate;trifluoroborane has a molecular weight of 169.85 g/mol, XLogP of -2.95, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;methanesulfonate;trifluoroborane is sourced from PubChem (CID 172736333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).