About anthracene;ethane;methanesulfonic acid
anthracene;ethane;methanesulfonic acid (PubChem CID 91545165) has the molecular formula C19H26O3S
and a molecular weight of 334.48 g/mol. Its IUPAC name is anthracene;ethane;methanesulfonic acid.
Molecular Properties
| Compound Name | anthracene;ethane;methanesulfonic acid |
| PubChem CID | 91545165 |
| Molecular Formula | C19H26O3S |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | anthracene;ethane;methanesulfonic acid |
| SMILES | CC.CC.CS(=O)(=O)O.c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10.2C2H6.CH4O3S/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;2*1-2;1-5(2,3)4/h1-10H;2*1-2H3;1H3,(H,2,3,4) |
| InChIKey | KUKMKWBPYBZEKQ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene;ethane;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene;ethane;methanesulfonic acid?
The IUPAC name of anthracene;ethane;methanesulfonic acid (CID 91545165) is anthracene;ethane;methanesulfonic acid.
What is the SMILES notation for anthracene;ethane;methanesulfonic acid?
The canonical SMILES for anthracene;ethane;methanesulfonic acid is CC.CC.CS(=O)(=O)O.c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of anthracene;ethane;methanesulfonic acid?
The InChIKey is KUKMKWBPYBZEKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.2C2H6.CH4O3S/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;2*1-2;1-5(2,3)4/h1-10H;2*1-2H3;1H3,(H,2,3,4).
What are the key properties of anthracene;ethane;methanesulfonic acid?
anthracene;ethane;methanesulfonic acid has a molecular weight of 334.48 g/mol, XLogP of 5.55, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene;ethane;methanesulfonic acid is sourced from PubChem (CID 91545165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).