About 2-(chloromethyl)naphthalene-1-carbaldehyde;quinolin-1-ium;chloride
2-(chloromethyl)naphthalene-1-carbaldehyde;quinolin-1-ium;chloride (PubChem CID 23358540) has the molecular formula C21H17Cl2NO
and a molecular weight of 370.28 g/mol. Its IUPAC name is 2-(chloromethyl)naphthalene-1-carbaldehyde;quinolin-1-ium;chloride.
Molecular Properties
| Compound Name | 2-(chloromethyl)naphthalene-1-carbaldehyde;quinolin-1-ium;chloride |
| PubChem CID | 23358540 |
| Molecular Formula | C21H17Cl2NO |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 2-(chloromethyl)naphthalene-1-carbaldehyde;quinolin-1-ium;chloride |
| SMILES | O=Cc1c(CCl)ccc2ccccc12.[Cl-].c1ccc2[nH+]cccc2c1 |
| InChI | InChI=1S/C12H9ClO.C9H7N.ClH/c13-7-10-6-5-9-3-1-2-4-11(9)12(10)8-14;1-2-6-9-8(4-1)5-3-7-10-9;/h1-6,8H,7H2;1-7H;1H |
| InChIKey | LFCGOORESIIELJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 31.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)naphthalene-1-carbaldehyde;quinolin-1-ium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)naphthalene-1-carbaldehyde;quinolin-1-ium;chloride?
The IUPAC name of 2-(chloromethyl)naphthalene-1-carbaldehyde;quinolin-1-ium;chloride (CID 23358540) is 2-(chloromethyl)naphthalene-1-carbaldehyde;quinolin-1-ium;chloride.
What is the SMILES notation for 2-(chloromethyl)naphthalene-1-carbaldehyde;quinolin-1-ium;chloride?
The canonical SMILES for 2-(chloromethyl)naphthalene-1-carbaldehyde;quinolin-1-ium;chloride is O=Cc1c(CCl)ccc2ccccc12.[Cl-].c1ccc2[nH+]cccc2c1.
What is the InChIKey of 2-(chloromethyl)naphthalene-1-carbaldehyde;quinolin-1-ium;chloride?
The InChIKey is LFCGOORESIIELJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9ClO.C9H7N.ClH/c13-7-10-6-5-9-3-1-2-4-11(9)12(10)8-14;1-2-6-9-8(4-1)5-3-7-10-9;/h1-6,8H,7H2;1-7H;1H.
What are the key properties of 2-(chloromethyl)naphthalene-1-carbaldehyde;quinolin-1-ium;chloride?
2-(chloromethyl)naphthalene-1-carbaldehyde;quinolin-1-ium;chloride has a molecular weight of 370.28 g/mol, XLogP of 2.05, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)naphthalene-1-carbaldehyde;quinolin-1-ium;chloride is sourced from PubChem (CID 23358540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).