C8H6F3NO3S2 — CID 157126773
thieno[2,3-b]pyridin-7-ium;trifluoromethanesulfonate (PubChem CID 157126773) has the molecular formula C8H6F3NO3S2 and a molecular weight of 285.27 g/mol. Its IUPAC name is thieno[2,3-b]pyridin-7-ium;trifluoromethanesulfonate.
| Compound Name | thieno[2,3-b]pyridin-7-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 157126773 |
| Molecular Formula | C8H6F3NO3S2 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 284.97 |
| IUPAC Name | thieno[2,3-b]pyridin-7-ium;trifluoromethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)F.c1c[nH+]c2sccc2c1 |
| InChI | InChI=1S/C7H5NS.CHF3O3S/c1-2-6-3-5-9-7(6)8-4-1;2-1(3,4)8(5,6)7/h1-5H;(H,5,6,7) |
| InChIKey | AIPCQVQSSKQODV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 71.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|