C8H10F3NO3S — CID 19757466
2-ethylpyridin-1-ium;trifluoromethanesulfonate (PubChem CID 19757466) has the molecular formula C8H10F3NO3S and a molecular weight of 257.23 g/mol. Its IUPAC name is 2-ethylpyridin-1-ium;trifluoromethanesulfonate.
| Compound Name | 2-ethylpyridin-1-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 19757466 |
| Molecular Formula | C8H10F3NO3S |
| Molecular Weight | 257.23 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 2-ethylpyridin-1-ium;trifluoromethanesulfonate |
| SMILES | CCc1cccc[nH+]1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C7H9N.CHF3O3S/c1-2-7-5-3-4-6-8-7;2-1(3,4)8(5,6)7/h3-6H,2H2,1H3;(H,5,6,7) |
| InChIKey | KCMIXDJYUKACAP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 71.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|