C25H27F3O3S2 — CID 159573066
diphenyl-(2,4,6-triethylphenyl)sulfanium;trifluoromethanesulfonate (PubChem CID 159573066) has the molecular formula C25H27F3O3S2 and a molecular weight of 496.62 g/mol. Its IUPAC name is diphenyl-(2,4,6-triethylphenyl)sulfanium;trifluoromethanesulfonate.
| Compound Name | diphenyl-(2,4,6-triethylphenyl)sulfanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 159573066 |
| Molecular Formula | C25H27F3O3S2 |
| Molecular Weight | 496.62 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | diphenyl-(2,4,6-triethylphenyl)sulfanium;trifluoromethanesulfonate |
| SMILES | CCc1cc(CC)c([S+](c2ccccc2)c2ccccc2)c(CC)c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C24H27S.CHF3O3S/c1-4-19-17-20(5-2)24(21(6-3)18-19)25(22-13-9-7-10-14-22)23-15-11-8-12-16-23;2-1(3,4)8(5,6)7/h7-18H,4-6H2,1-3H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | MIBJMVMUPOVFKZ-UHFFFAOYSA-M |
| XLogP | 6.52 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.62 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|