C11H16F3NO3S — CID 158269719
diethyl(phenyl)azanium;trifluoromethanesulfonate (PubChem CID 158269719) has the molecular formula C11H16F3NO3S and a molecular weight of 299.31 g/mol. Its IUPAC name is diethyl(phenyl)azanium;trifluoromethanesulfonate.
| Compound Name | diethyl(phenyl)azanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 158269719 |
| Molecular Formula | C11H16F3NO3S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | diethyl(phenyl)azanium;trifluoromethanesulfonate |
| SMILES | CC[NH+](CC)c1ccccc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C10H15N.CHF3O3S/c1-3-11(4-2)10-8-6-5-7-9-10;2-1(3,4)8(5,6)7/h5-9H,3-4H2,1-2H3;(H,5,6,7) |
| InChIKey | GIWMVWZDFQNXOA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 61.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|