C25H28F3O3PS — CID 162187354
phenyl-bis(4-propylphenyl)phosphanium;trifluoromethanesulfonate (PubChem CID 162187354) has the molecular formula C25H28F3O3PS and a molecular weight of 496.53 g/mol. Its IUPAC name is phenyl-bis(4-propylphenyl)phosphanium;trifluoromethanesulfonate.
| Compound Name | phenyl-bis(4-propylphenyl)phosphanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162187354 |
| Molecular Formula | C25H28F3O3PS |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | phenyl-bis(4-propylphenyl)phosphanium;trifluoromethanesulfonate |
| SMILES | CCCc1ccc([PH+](c2ccccc2)c2ccc(CCC)cc2)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C24H27P.CHF3O3S/c1-3-8-20-12-16-23(17-13-20)25(22-10-6-5-7-11-22)24-18-14-21(9-4-2)15-19-24;2-1(3,4)8(5,6)7/h5-7,10-19H,3-4,8-9H2,1-2H3;(H,5,6,7) |
| InChIKey | ZPVJCDIIEPSWCQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|