C12H14F2O2 — CID 116838337
3,3-difluoro-3-(4-propylphenyl)propanoic acid (PubChem CID 116838337) has the molecular formula C12H14F2O2 and a molecular weight of 228.24 g/mol. Its IUPAC name is 3,3-difluoro-3-(4-propylphenyl)propanoic acid.
| Compound Name | 3,3-difluoro-3-(4-propylphenyl)propanoic acid |
|---|---|
| PubChem CID | 116838337 |
| Molecular Formula | C12H14F2O2 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 3,3-difluoro-3-(4-propylphenyl)propanoic acid |
| SMILES | CCCc1ccc(C(F)(F)CC(=O)O)cc1 |
| InChI | InChI=1S/C12H14F2O2/c1-2-3-9-4-6-10(7-5-9)12(13,14)8-11(15)16/h4-7H,2-3,8H2,1H3,(H,15,16) |
| InChIKey | KJZNCUXFCPZDFZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |