C11H11F5 — CID 71656112
1-(1,1,2,2,2-pentafluoroethyl)-4-propylbenzene (PubChem CID 71656112) has the molecular formula C11H11F5 and a molecular weight of 238.20 g/mol. Its IUPAC name is 1-(1,1,2,2,2-pentafluoroethyl)-4-propylbenzene.
| Compound Name | 1-(1,1,2,2,2-pentafluoroethyl)-4-propylbenzene |
|---|---|
| PubChem CID | 71656112 |
| Molecular Formula | C11H11F5 |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 1-(1,1,2,2,2-pentafluoroethyl)-4-propylbenzene |
| SMILES | CCCc1ccc(C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H11F5/c1-2-3-8-4-6-9(7-5-8)10(12,13)11(14,15)16/h4-7H,2-3H2,1H3 |
| InChIKey | OMWVMLZLLHLICL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|