C31H39F5 — CID 141052812
1-(1,1,2,2,2-pentafluoroethyl)-4-[4-[4-(4-pentylphenyl)cyclohexyl]cyclohexyl]benzene (PubChem CID 141052812) has the molecular formula C31H39F5 and a molecular weight of 506.64 g/mol. Its IUPAC name is 1-(1,1,2,2,2-pentafluoroethyl)-4-[4-[4-(4-pentylphenyl)cyclohexyl]cyclohexyl]benzene.
| Compound Name | 1-(1,1,2,2,2-pentafluoroethyl)-4-[4-[4-(4-pentylphenyl)cyclohexyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 141052812 |
| Molecular Formula | C31H39F5 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.30 |
| IUPAC Name | 1-(1,1,2,2,2-pentafluoroethyl)-4-[4-[4-(4-pentylphenyl)cyclohexyl]cyclohexyl]benzene |
| SMILES | CCCCCc1ccc(C2CCC(C3CCC(c4ccc(C(F)(F)C(F)(F)F)cc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C31H39F5/c1-2-3-4-5-22-6-8-23(9-7-22)24-10-12-25(13-11-24)26-14-16-27(17-15-26)28-18-20-29(21-19-28)30(32,33)31(34,35)36/h6-9,18-21,24-27H,2-5,10-17H2,1H3 |
| InChIKey | QTQNBXNTGSIWBZ-UHFFFAOYSA-N |
| XLogP | 10.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|