C19H25F5 — CID 18650649
1-[4-(1,1,2,2,2-pentafluoroethyl)cyclohexyl]-4-pentylbenzene (PubChem CID 18650649) has the molecular formula C19H25F5 and a molecular weight of 348.40 g/mol. Its IUPAC name is 1-[4-(1,1,2,2,2-pentafluoroethyl)cyclohexyl]-4-pentylbenzene.
| Compound Name | 1-[4-(1,1,2,2,2-pentafluoroethyl)cyclohexyl]-4-pentylbenzene |
|---|---|
| PubChem CID | 18650649 |
| Molecular Formula | C19H25F5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 1-[4-(1,1,2,2,2-pentafluoroethyl)cyclohexyl]-4-pentylbenzene |
| SMILES | CCCCCc1ccc(C2CCC(C(F)(F)C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C19H25F5/c1-2-3-4-5-14-6-8-15(9-7-14)16-10-12-17(13-11-16)18(20,21)19(22,23)24/h6-9,16-17H,2-5,10-13H2,1H3 |
| InChIKey | KGWMXKKXYUZVLI-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|