C17H15F4I — CID 139623961
1-iodo-4-[1,1,2,2-tetrafluoro-2-(4-propylphenyl)ethyl]benzene (PubChem CID 139623961) has the molecular formula C17H15F4I and a molecular weight of 422.20 g/mol. Its IUPAC name is 1-iodo-4-[1,1,2,2-tetrafluoro-2-(4-propylphenyl)ethyl]benzene.
| Compound Name | 1-iodo-4-[1,1,2,2-tetrafluoro-2-(4-propylphenyl)ethyl]benzene |
|---|---|
| PubChem CID | 139623961 |
| Molecular Formula | C17H15F4I |
| Molecular Weight | 422.20 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | 1-iodo-4-[1,1,2,2-tetrafluoro-2-(4-propylphenyl)ethyl]benzene |
| SMILES | CCCc1ccc(C(F)(F)C(F)(F)c2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C17H15F4I/c1-2-3-12-4-6-13(7-5-12)16(18,19)17(20,21)14-8-10-15(22)11-9-14/h4-11H,2-3H2,1H3 |
| InChIKey | UEUJZSRTGGIHHZ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.20 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|