C20H21F5S — CID 54525557
[4-[1,1,2,2-tetrafluoro-2-(4-hexylphenyl)ethyl]phenyl] thiohypofluorite (PubChem CID 54525557) has the molecular formula C20H21F5S and a molecular weight of 388.45 g/mol. Its IUPAC name is [4-[1,1,2,2-tetrafluoro-2-(4-hexylphenyl)ethyl]phenyl] thiohypofluorite.
| Compound Name | [4-[1,1,2,2-tetrafluoro-2-(4-hexylphenyl)ethyl]phenyl] thiohypofluorite |
|---|---|
| PubChem CID | 54525557 |
| Molecular Formula | C20H21F5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | [4-[1,1,2,2-tetrafluoro-2-(4-hexylphenyl)ethyl]phenyl] thiohypofluorite |
| SMILES | CCCCCCc1ccc(C(F)(F)C(F)(F)c2ccc(SF)cc2)cc1 |
| InChI | InChI=1S/C20H21F5S/c1-2-3-4-5-6-15-7-9-16(10-8-15)19(21,22)20(23,24)17-11-13-18(26-25)14-12-17/h7-14H,2-6H2,1H3 |
| InChIKey | YSWFEZKHOVKHIU-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|