About (4-undecylphenyl) thiohypochlorite
(4-undecylphenyl) thiohypochlorite (PubChem CID 144733543) has the molecular formula C17H27ClS
and a molecular weight of 298.92 g/mol. Its IUPAC name is (4-undecylphenyl) thiohypochlorite.
Molecular Properties
| Compound Name | (4-undecylphenyl) thiohypochlorite |
| PubChem CID | 144733543 |
| Molecular Formula | C17H27ClS |
| Molecular Weight | 298.92 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | (4-undecylphenyl) thiohypochlorite |
| SMILES | CCCCCCCCCCCc1ccc(SCl)cc1 |
| InChI | InChI=1S/C17H27ClS/c1-2-3-4-5-6-7-8-9-10-11-16-12-14-17(19-18)15-13-16/h12-15H,2-11H2,1H3 |
| InChIKey | KLRYTWLDVBEARU-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.92 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4-undecylphenyl) thiohypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-undecylphenyl) thiohypochlorite?
The IUPAC name of (4-undecylphenyl) thiohypochlorite (CID 144733543) is (4-undecylphenyl) thiohypochlorite.
What is the SMILES notation for (4-undecylphenyl) thiohypochlorite?
The canonical SMILES for (4-undecylphenyl) thiohypochlorite is CCCCCCCCCCCc1ccc(SCl)cc1.
What is the InChIKey of (4-undecylphenyl) thiohypochlorite?
The InChIKey is KLRYTWLDVBEARU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27ClS/c1-2-3-4-5-6-7-8-9-10-11-16-12-14-17(19-18)15-13-16/h12-15H,2-11H2,1H3.
What are the key properties of (4-undecylphenyl) thiohypochlorite?
(4-undecylphenyl) thiohypochlorite has a molecular weight of 298.92 g/mol, XLogP of 7.01, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-undecylphenyl) thiohypochlorite is sourced from PubChem (CID 144733543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).