About (4-hexylphenyl) carbamodithioate
(4-hexylphenyl) carbamodithioate (PubChem CID 174477141) has the molecular formula C13H19NS2
and a molecular weight of 253.44 g/mol. Its IUPAC name is (4-hexylphenyl) carbamodithioate.
Molecular Properties
| Compound Name | (4-hexylphenyl) carbamodithioate |
| PubChem CID | 174477141 |
| Molecular Formula | C13H19NS2 |
| Molecular Weight | 253.44 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | (4-hexylphenyl) carbamodithioate |
| SMILES | CCCCCCc1ccc(SC(N)=S)cc1 |
| InChI | InChI=1S/C13H19NS2/c1-2-3-4-5-6-11-7-9-12(10-8-11)16-13(14)15/h7-10H,2-6H2,1H3,(H2,14,15) |
| InChIKey | SAEVCMMPOFIRHB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4-hexylphenyl) carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hexylphenyl) carbamodithioate?
The IUPAC name of (4-hexylphenyl) carbamodithioate (CID 174477141) is (4-hexylphenyl) carbamodithioate.
What is the SMILES notation for (4-hexylphenyl) carbamodithioate?
The canonical SMILES for (4-hexylphenyl) carbamodithioate is CCCCCCc1ccc(SC(N)=S)cc1.
What is the InChIKey of (4-hexylphenyl) carbamodithioate?
The InChIKey is SAEVCMMPOFIRHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NS2/c1-2-3-4-5-6-11-7-9-12(10-8-11)16-13(14)15/h7-10H,2-6H2,1H3,(H2,14,15).
What are the key properties of (4-hexylphenyl) carbamodithioate?
(4-hexylphenyl) carbamodithioate has a molecular weight of 253.44 g/mol, XLogP of 4.15, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hexylphenyl) carbamodithioate is sourced from PubChem (CID 174477141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).