About (4-dodecylphenyl)methyl thiohypochlorite
(4-dodecylphenyl)methyl thiohypochlorite (PubChem CID 22894472) has the molecular formula C19H31ClS
and a molecular weight of 326.98 g/mol. Its IUPAC name is (4-dodecylphenyl)methyl thiohypochlorite.
Molecular Properties
| Compound Name | (4-dodecylphenyl)methyl thiohypochlorite |
| PubChem CID | 22894472 |
| Molecular Formula | C19H31ClS |
| Molecular Weight | 326.98 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | (4-dodecylphenyl)methyl thiohypochlorite |
| SMILES | CCCCCCCCCCCCc1ccc(CSCl)cc1 |
| InChI | InChI=1S/C19H31ClS/c1-2-3-4-5-6-7-8-9-10-11-12-18-13-15-19(16-14-18)17-21-20/h13-16H,2-12,17H2,1H3 |
| InChIKey | QNVCMROYCQVZPS-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.98 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4-dodecylphenyl)methyl thiohypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-dodecylphenyl)methyl thiohypochlorite?
The IUPAC name of (4-dodecylphenyl)methyl thiohypochlorite (CID 22894472) is (4-dodecylphenyl)methyl thiohypochlorite.
What is the SMILES notation for (4-dodecylphenyl)methyl thiohypochlorite?
The canonical SMILES for (4-dodecylphenyl)methyl thiohypochlorite is CCCCCCCCCCCCc1ccc(CSCl)cc1.
What is the InChIKey of (4-dodecylphenyl)methyl thiohypochlorite?
The InChIKey is QNVCMROYCQVZPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31ClS/c1-2-3-4-5-6-7-8-9-10-11-12-18-13-15-19(16-14-18)17-21-20/h13-16H,2-12,17H2,1H3.
What are the key properties of (4-dodecylphenyl)methyl thiohypochlorite?
(4-dodecylphenyl)methyl thiohypochlorite has a molecular weight of 326.98 g/mol, XLogP of 7.54, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-dodecylphenyl)methyl thiohypochlorite is sourced from PubChem (CID 22894472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).