C36H46F4O2 — CID 70177776
1-[difluoro-(4-heptylphenoxy)methyl]-4-[difluoro-(4-nonylphenoxy)methyl]benzene (PubChem CID 70177776) has the molecular formula C36H46F4O2 and a molecular weight of 586.75 g/mol. Its IUPAC name is 1-[difluoro-(4-heptylphenoxy)methyl]-4-[difluoro-(4-nonylphenoxy)methyl]benzene.
| Compound Name | 1-[difluoro-(4-heptylphenoxy)methyl]-4-[difluoro-(4-nonylphenoxy)methyl]benzene |
|---|---|
| PubChem CID | 70177776 |
| Molecular Formula | C36H46F4O2 |
| Molecular Weight | 586.75 g/mol |
| Exact Mass | 586.34 |
| IUPAC Name | 1-[difluoro-(4-heptylphenoxy)methyl]-4-[difluoro-(4-nonylphenoxy)methyl]benzene |
| SMILES | CCCCCCCCCc1ccc(OC(F)(F)c2ccc(C(F)(F)Oc3ccc(CCCCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H46F4O2/c1-3-5-7-9-10-12-14-16-30-19-27-34(28-20-30)42-36(39,40)32-23-21-31(22-24-32)35(37,38)41-33-25-17-29(18-26-33)15-13-11-8-6-4-2/h17-28H,3-16H2,1-2H3 |
| InChIKey | NNJZRRDIARQCAJ-UHFFFAOYSA-N |
| XLogP | 11.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.75 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|