C39H34F6O — CID 59328953
5-[4-[4-[4-[difluoro-(4-pentylphenyl)methoxy]phenyl]-2-fluorophenyl]-2-fluorophenyl]-1,3-difluoro-2-propylbenzene (PubChem CID 59328953) has the molecular formula C39H34F6O and a molecular weight of 632.69 g/mol. Its IUPAC name is 5-[4-[4-[4-[difluoro-(4-pentylphenyl)methoxy]phenyl]-2-fluorophenyl]-2-fluorophenyl]-1,3-difluoro-2-propylbenzene.
| Compound Name | 5-[4-[4-[4-[difluoro-(4-pentylphenyl)methoxy]phenyl]-2-fluorophenyl]-2-fluorophenyl]-1,3-difluoro-2-propylbenzene |
|---|---|
| PubChem CID | 59328953 |
| Molecular Formula | C39H34F6O |
| Molecular Weight | 632.69 g/mol |
| Exact Mass | 632.25 |
| IUPAC Name | 5-[4-[4-[4-[difluoro-(4-pentylphenyl)methoxy]phenyl]-2-fluorophenyl]-2-fluorophenyl]-1,3-difluoro-2-propylbenzene |
| SMILES | CCCCCc1ccc(C(F)(F)Oc2ccc(-c3ccc(-c4ccc(-c5cc(F)c(CCC)c(F)c5)c(F)c4)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C39H34F6O/c1-3-5-6-8-25-9-15-30(16-10-25)39(44,45)46-31-17-11-26(12-18-31)27-13-19-32(35(40)21-27)28-14-20-33(36(41)22-28)29-23-37(42)34(7-4-2)38(43)24-29/h9-24H,3-8H2,1-2H3 |
| InChIKey | WXRBEFDTXHYDFV-UHFFFAOYSA-N |
| XLogP | 12.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.69 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|