C34H26F6N2O — CID 58383520
2-[4-[difluoro-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenoxy]methyl]phenyl]-5-pentylpyrimidine (PubChem CID 58383520) has the molecular formula C34H26F6N2O and a molecular weight of 592.58 g/mol. Its IUPAC name is 2-[4-[difluoro-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenoxy]methyl]phenyl]-5-pentylpyrimidine.
| Compound Name | 2-[4-[difluoro-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenoxy]methyl]phenyl]-5-pentylpyrimidine |
|---|---|
| PubChem CID | 58383520 |
| Molecular Formula | C34H26F6N2O |
| Molecular Weight | 592.58 g/mol |
| Exact Mass | 592.19 |
| IUPAC Name | 2-[4-[difluoro-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenoxy]methyl]phenyl]-5-pentylpyrimidine |
| SMILES | CCCCCc1cnc(-c2ccc(C(F)(F)Oc3ccc(-c4ccc(-c5cc(F)c(F)c(F)c5)c(F)c4)cc3)cc2)nc1 |
| InChI | InChI=1S/C34H26F6N2O/c1-2-3-4-5-21-19-41-33(42-20-21)23-6-11-26(12-7-23)34(39,40)43-27-13-8-22(9-14-27)24-10-15-28(29(35)16-24)25-17-30(36)32(38)31(37)18-25/h6-20H,2-5H2,1H3 |
| InChIKey | YNHXOKRJULAWFN-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.58 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|