C34H24ClF7N2O — CID 58383293
2-[4-[[4-[4-(4-chloro-3,5-difluorophenyl)-3-fluorophenyl]phenoxy]-difluoromethyl]-3,5-difluorophenyl]-5-pentylpyrimidine (PubChem CID 58383293) has the molecular formula C34H24ClF7N2O and a molecular weight of 645.02 g/mol. Its IUPAC name is 2-[4-[[4-[4-(4-chloro-3,5-difluorophenyl)-3-fluorophenyl]phenoxy]-difluoromethyl]-3,5-difluorophenyl]-5-pentylpyrimidine.
| Compound Name | 2-[4-[[4-[4-(4-chloro-3,5-difluorophenyl)-3-fluorophenyl]phenoxy]-difluoromethyl]-3,5-difluorophenyl]-5-pentylpyrimidine |
|---|---|
| PubChem CID | 58383293 |
| Molecular Formula | C34H24ClF7N2O |
| Molecular Weight | 645.02 g/mol |
| Exact Mass | 644.15 |
| IUPAC Name | 2-[4-[[4-[4-(4-chloro-3,5-difluorophenyl)-3-fluorophenyl]phenoxy]-difluoromethyl]-3,5-difluorophenyl]-5-pentylpyrimidine |
| SMILES | CCCCCc1cnc(-c2cc(F)c(C(F)(F)Oc3ccc(-c4ccc(-c5cc(F)c(Cl)c(F)c5)c(F)c4)cc3)c(F)c2)nc1 |
| InChI | InChI=1S/C34H24ClF7N2O/c1-2-3-4-5-19-17-43-33(44-18-19)23-15-27(37)31(28(38)16-23)34(41,42)45-24-9-6-20(7-10-24)21-8-11-25(26(36)12-21)22-13-29(39)32(35)30(40)14-22/h6-18H,2-5H2,1H3 |
| InChIKey | XVHGTLVUKIOBDF-UHFFFAOYSA-N |
| XLogP | 10.69 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.02 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|