C34H26ClF5N2O — CID 58383581
2-[4-[[4-[4-(4-chlorophenyl)-3-fluorophenyl]-3-fluorophenoxy]-difluoromethyl]-3-fluorophenyl]-5-pentylpyrimidine (PubChem CID 58383581) has the molecular formula C34H26ClF5N2O and a molecular weight of 609.04 g/mol. Its IUPAC name is 2-[4-[[4-[4-(4-chlorophenyl)-3-fluorophenyl]-3-fluorophenoxy]-difluoromethyl]-3-fluorophenyl]-5-pentylpyrimidine.
| Compound Name | 2-[4-[[4-[4-(4-chlorophenyl)-3-fluorophenyl]-3-fluorophenoxy]-difluoromethyl]-3-fluorophenyl]-5-pentylpyrimidine |
|---|---|
| PubChem CID | 58383581 |
| Molecular Formula | C34H26ClF5N2O |
| Molecular Weight | 609.04 g/mol |
| Exact Mass | 608.17 |
| IUPAC Name | 2-[4-[[4-[4-(4-chlorophenyl)-3-fluorophenyl]-3-fluorophenoxy]-difluoromethyl]-3-fluorophenyl]-5-pentylpyrimidine |
| SMILES | CCCCCc1cnc(-c2ccc(C(F)(F)Oc3ccc(-c4ccc(-c5ccc(Cl)cc5)c(F)c4)c(F)c3)c(F)c2)nc1 |
| InChI | InChI=1S/C34H26ClF5N2O/c1-2-3-4-5-21-19-41-33(42-20-21)24-9-15-29(32(38)17-24)34(39,40)43-26-12-14-28(31(37)18-26)23-8-13-27(30(36)16-23)22-6-10-25(35)11-7-22/h6-20H,2-5H2,1H3 |
| InChIKey | LNSPXNUDZQJNFK-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.04 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|