C36H27F7O2 — CID 59328376
5-[difluoro-[4-[2-fluoro-4-[2-fluoro-4-(4-pentoxyphenyl)phenyl]phenyl]phenyl]methoxy]-1,2,3-trifluorobenzene (PubChem CID 59328376) has the molecular formula C36H27F7O2 and a molecular weight of 624.60 g/mol. Its IUPAC name is 5-[difluoro-[4-[2-fluoro-4-[2-fluoro-4-(4-pentoxyphenyl)phenyl]phenyl]phenyl]methoxy]-1,2,3-trifluorobenzene.
| Compound Name | 5-[difluoro-[4-[2-fluoro-4-[2-fluoro-4-(4-pentoxyphenyl)phenyl]phenyl]phenyl]methoxy]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 59328376 |
| Molecular Formula | C36H27F7O2 |
| Molecular Weight | 624.60 g/mol |
| Exact Mass | 624.19 |
| IUPAC Name | 5-[difluoro-[4-[2-fluoro-4-[2-fluoro-4-(4-pentoxyphenyl)phenyl]phenyl]phenyl]methoxy]-1,2,3-trifluorobenzene |
| SMILES | CCCCCOc1ccc(-c2ccc(-c3ccc(-c4ccc(C(F)(F)Oc5cc(F)c(F)c(F)c5)cc4)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C36H27F7O2/c1-2-3-4-17-44-27-13-7-22(8-14-27)24-9-15-30(31(37)18-24)25-10-16-29(32(38)19-25)23-5-11-26(12-6-23)36(42,43)45-28-20-33(39)35(41)34(40)21-28/h5-16,18-21H,2-4,17H2,1H3 |
| InChIKey | DMDWOCWXJBSVME-UHFFFAOYSA-N |
| XLogP | 11.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.60 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|