C37H28F5NO — CID 59328723
4-[4-[4-[4-[difluoro-(4-pentylphenyl)methoxy]-2-fluorophenyl]-2-fluorophenyl]-2-fluorophenyl]benzonitrile (PubChem CID 59328723) has the molecular formula C37H28F5NO and a molecular weight of 597.63 g/mol. Its IUPAC name is 4-[4-[4-[4-[difluoro-(4-pentylphenyl)methoxy]-2-fluorophenyl]-2-fluorophenyl]-2-fluorophenyl]benzonitrile.
| Compound Name | 4-[4-[4-[4-[difluoro-(4-pentylphenyl)methoxy]-2-fluorophenyl]-2-fluorophenyl]-2-fluorophenyl]benzonitrile |
|---|---|
| PubChem CID | 59328723 |
| Molecular Formula | C37H28F5NO |
| Molecular Weight | 597.63 g/mol |
| Exact Mass | 597.21 |
| IUPAC Name | 4-[4-[4-[4-[difluoro-(4-pentylphenyl)methoxy]-2-fluorophenyl]-2-fluorophenyl]-2-fluorophenyl]benzonitrile |
| SMILES | CCCCCc1ccc(C(F)(F)Oc2ccc(-c3ccc(-c4ccc(-c5ccc(C#N)cc5)c(F)c4)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C37H28F5NO/c1-2-3-4-5-24-8-14-29(15-9-24)37(41,42)44-30-16-19-33(36(40)22-30)28-13-18-32(35(39)21-28)27-12-17-31(34(38)20-27)26-10-6-25(23-43)7-11-26/h6-22H,2-5H2,1H3 |
| InChIKey | ZMZRTTCLRTYXGY-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.63 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|